C30H25NO10S — CID 126186559
phenacyl 2-[(2S)-4-methylsulfonyl-1-oxo-1-phenacyloxybutan-2-yl]-1,3-dioxoisoindole-5-carboxylate (PubChem CID 126186559) has the molecular formula C30H25NO10S and a molecular weight of 591.59 g/mol. Its IUPAC name is phenacyl 2-[(2S)-4-methylsulfonyl-1-oxo-1-phenacyloxybutan-2-yl]-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | phenacyl 2-[(2S)-4-methylsulfonyl-1-oxo-1-phenacyloxybutan-2-yl]-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 126186559 |
| Molecular Formula | C30H25NO10S |
| Molecular Weight | 591.59 g/mol |
| Exact Mass | 591.12 |
| IUPAC Name | phenacyl 2-[(2S)-4-methylsulfonyl-1-oxo-1-phenacyloxybutan-2-yl]-1,3-dioxoisoindole-5-carboxylate |
| SMILES | CS(=O)(=O)CC[C@@H](C(=O)OCC(=O)c1ccccc1)N1C(=O)c2ccc(C(=O)OCC(=O)c3ccccc3)cc2C1=O |
| InChI | InChI=1S/C30H25NO10S/c1-42(38,39)15-14-24(30(37)41-18-26(33)20-10-6-3-7-11-20)31-27(34)22-13-12-21(16-23(22)28(31)35)29(36)40-17-25(32)19-8-4-2-5-9-19/h2-13,16,24H,14-15,17-18H2,1H3/t24-/m0/s1 |
| InChIKey | QPEXDDRXVTXBIU-DEOSSOPVSA-N |
| XLogP | 2.55 |
| TPSA | 158.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.59 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|