C14H13NO8S — CID 2191194
2-[(1R)-1-carboxy-3-methylsulfonylpropyl]-1,3-dioxoisoindole-5-carboxylic acid (PubChem CID 2191194) has the molecular formula C14H13NO8S and a molecular weight of 355.32 g/mol. Its IUPAC name is 2-[(1R)-1-carboxy-3-methylsulfonylpropyl]-1,3-dioxoisoindole-5-carboxylic acid.
| Compound Name | 2-[(1R)-1-carboxy-3-methylsulfonylpropyl]-1,3-dioxoisoindole-5-carboxylic acid |
|---|---|
| PubChem CID | 2191194 |
| Molecular Formula | C14H13NO8S |
| Molecular Weight | 355.32 g/mol |
| Exact Mass | 355.04 |
| IUPAC Name | 2-[(1R)-1-carboxy-3-methylsulfonylpropyl]-1,3-dioxoisoindole-5-carboxylic acid |
| SMILES | CS(=O)(=O)CC[C@H](C(=O)O)N1C(=O)c2ccc(C(=O)O)cc2C1=O |
| InChI | InChI=1S/C14H13NO8S/c1-24(22,23)5-4-10(14(20)21)15-11(16)8-3-2-7(13(18)19)6-9(8)12(15)17/h2-3,6,10H,4-5H2,1H3,(H,18,19)(H,20,21)/t10-/m1/s1 |
| InChIKey | RTYPQKDAFQMBCD-SNVBAGLBSA-N |
| XLogP | -0.13 |
| TPSA | 146.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.32 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|