C19H14N2O7 — CID 16752649
2-[(1R)-2-(4-carbamoylphenyl)-1-carboxyethyl]-1,3-dioxoisoindole-5-carboxylic acid (PubChem CID 16752649) has the molecular formula C19H14N2O7 and a molecular weight of 382.33 g/mol. Its IUPAC name is 2-[(1R)-2-(4-carbamoylphenyl)-1-carboxyethyl]-1,3-dioxoisoindole-5-carboxylic acid.
| Compound Name | 2-[(1R)-2-(4-carbamoylphenyl)-1-carboxyethyl]-1,3-dioxoisoindole-5-carboxylic acid |
|---|---|
| PubChem CID | 16752649 |
| Molecular Formula | C19H14N2O7 |
| Molecular Weight | 382.33 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | 2-[(1R)-2-(4-carbamoylphenyl)-1-carboxyethyl]-1,3-dioxoisoindole-5-carboxylic acid |
| SMILES | NC(=O)c1ccc(C[C@H](C(=O)O)N2C(=O)c3ccc(C(=O)O)cc3C2=O)cc1 |
| InChI | InChI=1S/C19H14N2O7/c20-15(22)10-3-1-9(2-4-10)7-14(19(27)28)21-16(23)12-6-5-11(18(25)26)8-13(12)17(21)24/h1-6,8,14H,7H2,(H2,20,22)(H,25,26)(H,27,28)/t14-/m1/s1 |
| InChIKey | RJBSTXFVZFQOGX-CQSZACIVSA-N |
| XLogP | 0.78 |
| TPSA | 155.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.33 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|