C15H20N2O3 — CID 145140796
1,3-dioxo-2-propan-2-ylisoindole-5-carboxamide;propane (PubChem CID 145140796) has the molecular formula C15H20N2O3 and a molecular weight of 276.34 g/mol. Its IUPAC name is 1,3-dioxo-2-propan-2-ylisoindole-5-carboxamide;propane.
| Compound Name | 1,3-dioxo-2-propan-2-ylisoindole-5-carboxamide;propane |
|---|---|
| PubChem CID | 145140796 |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | 1,3-dioxo-2-propan-2-ylisoindole-5-carboxamide;propane |
| SMILES | CC(C)N1C(=O)c2ccc(C(N)=O)cc2C1=O.CCC |
| InChI | InChI=1S/C12H12N2O3.C3H8/c1-6(2)14-11(16)8-4-3-7(10(13)15)5-9(8)12(14)17;1-3-2/h3-6H,1-2H3,(H2,13,15);3H2,1-2H3 |
| InChIKey | VNHCQCMPGUZFOM-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|