C16H19N3O4 — CID 108571800
N-(2-acetamidoethyl)-1,3-dioxo-2-propan-2-ylisoindole-5-carboxamide (PubChem CID 108571800) has the molecular formula C16H19N3O4 and a molecular weight of 317.35 g/mol. Its IUPAC name is N-(2-acetamidoethyl)-1,3-dioxo-2-propan-2-ylisoindole-5-carboxamide.
| Compound Name | N-(2-acetamidoethyl)-1,3-dioxo-2-propan-2-ylisoindole-5-carboxamide |
|---|---|
| PubChem CID | 108571800 |
| Molecular Formula | C16H19N3O4 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | N-(2-acetamidoethyl)-1,3-dioxo-2-propan-2-ylisoindole-5-carboxamide |
| SMILES | CC(=O)NCCNC(=O)c1ccc2c(c1)C(=O)N(C(C)C)C2=O |
| InChI | InChI=1S/C16H19N3O4/c1-9(2)19-15(22)12-5-4-11(8-13(12)16(19)23)14(21)18-7-6-17-10(3)20/h4-5,8-9H,6-7H2,1-3H3,(H,17,20)(H,18,21) |
| InChIKey | HESNMOIKIRNKRF-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|