C22H23N3O4 — CID 108540227
N-[2-[(2-methylbenzoyl)amino]ethyl]-1,3-dioxo-2-propan-2-ylisoindole-5-carboxamide (PubChem CID 108540227) has the molecular formula C22H23N3O4 and a molecular weight of 393.44 g/mol. Its IUPAC name is N-[2-[(2-methylbenzoyl)amino]ethyl]-1,3-dioxo-2-propan-2-ylisoindole-5-carboxamide.
| Compound Name | N-[2-[(2-methylbenzoyl)amino]ethyl]-1,3-dioxo-2-propan-2-ylisoindole-5-carboxamide |
|---|---|
| PubChem CID | 108540227 |
| Molecular Formula | C22H23N3O4 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | N-[2-[(2-methylbenzoyl)amino]ethyl]-1,3-dioxo-2-propan-2-ylisoindole-5-carboxamide |
| SMILES | Cc1ccccc1C(=O)NCCNC(=O)c1ccc2c(c1)C(=O)N(C(C)C)C2=O |
| InChI | InChI=1S/C22H23N3O4/c1-13(2)25-21(28)17-9-8-15(12-18(17)22(25)29)19(26)23-10-11-24-20(27)16-7-5-4-6-14(16)3/h4-9,12-13H,10-11H2,1-3H3,(H,23,26)(H,24,27) |
| InChIKey | WXXMDWMVMKYFID-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|