C21H21N3O4 — CID 108537941
N-[2-[2-(1,3-dioxoisoindol-2-yl)propanoylamino]ethyl]-4-methylbenzamide (PubChem CID 108537941) has the molecular formula C21H21N3O4 and a molecular weight of 379.42 g/mol. Its IUPAC name is N-[2-[2-(1,3-dioxoisoindol-2-yl)propanoylamino]ethyl]-4-methylbenzamide.
| Compound Name | N-[2-[2-(1,3-dioxoisoindol-2-yl)propanoylamino]ethyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 108537941 |
| Molecular Formula | C21H21N3O4 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | N-[2-[2-(1,3-dioxoisoindol-2-yl)propanoylamino]ethyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NCCNC(=O)C(C)N2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C21H21N3O4/c1-13-7-9-15(10-8-13)19(26)23-12-11-22-18(25)14(2)24-20(27)16-5-3-4-6-17(16)21(24)28/h3-10,14H,11-12H2,1-2H3,(H,22,25)(H,23,26) |
| InChIKey | MVQWCQMFNRJVTF-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|