C20H17F2N3O4 — CID 108571861
N-[2-[2-(1,3-dioxoisoindol-2-yl)propanoylamino]ethyl]-2,4-difluorobenzamide (PubChem CID 108571861) has the molecular formula C20H17F2N3O4 and a molecular weight of 401.37 g/mol. Its IUPAC name is N-[2-[2-(1,3-dioxoisoindol-2-yl)propanoylamino]ethyl]-2,4-difluorobenzamide.
| Compound Name | N-[2-[2-(1,3-dioxoisoindol-2-yl)propanoylamino]ethyl]-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 108571861 |
| Molecular Formula | C20H17F2N3O4 |
| Molecular Weight | 401.37 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | N-[2-[2-(1,3-dioxoisoindol-2-yl)propanoylamino]ethyl]-2,4-difluorobenzamide |
| SMILES | CC(C(=O)NCCNC(=O)c1ccc(F)cc1F)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C20H17F2N3O4/c1-11(25-19(28)13-4-2-3-5-14(13)20(25)29)17(26)23-8-9-24-18(27)15-7-6-12(21)10-16(15)22/h2-7,10-11H,8-9H2,1H3,(H,23,26)(H,24,27) |
| InChIKey | OEOQHEAPNRLBLQ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.37 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|