C28H25N3O7 — CID 108930771
[4-[[3-[(1,3-dioxo-2-propan-2-ylisoindole-5-carbonyl)amino]phenyl]carbamoyl]phenyl] ethyl carbonate (PubChem CID 108930771) has the molecular formula C28H25N3O7 and a molecular weight of 515.52 g/mol. Its IUPAC name is [4-[[3-[(1,3-dioxo-2-propan-2-ylisoindole-5-carbonyl)amino]phenyl]carbamoyl]phenyl] ethyl carbonate.
| Compound Name | [4-[[3-[(1,3-dioxo-2-propan-2-ylisoindole-5-carbonyl)amino]phenyl]carbamoyl]phenyl] ethyl carbonate |
|---|---|
| PubChem CID | 108930771 |
| Molecular Formula | C28H25N3O7 |
| Molecular Weight | 515.52 g/mol |
| Exact Mass | 515.17 |
| IUPAC Name | [4-[[3-[(1,3-dioxo-2-propan-2-ylisoindole-5-carbonyl)amino]phenyl]carbamoyl]phenyl] ethyl carbonate |
| SMILES | CCOC(=O)Oc1ccc(C(=O)Nc2cccc(NC(=O)c3ccc4c(c3)C(=O)N(C(C)C)C4=O)c2)cc1 |
| InChI | InChI=1S/C28H25N3O7/c1-4-37-28(36)38-21-11-8-17(9-12-21)24(32)29-19-6-5-7-20(15-19)30-25(33)18-10-13-22-23(14-18)27(35)31(16(2)3)26(22)34/h5-16H,4H2,1-3H3,(H,29,32)(H,30,33) |
| InChIKey | OZRIBTFLTMTCHW-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.52 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|