C18H11NO7-2 — CID 7013168
2-[(1R)-1-carboxylato-2-(4-hydroxyphenyl)ethyl]-1,3-dioxoisoindole-5-carboxylate (PubChem CID 7013168) has the molecular formula C18H11NO7-2 and a molecular weight of 353.29 g/mol. Its IUPAC name is 2-[(1R)-1-carboxylato-2-(4-hydroxyphenyl)ethyl]-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | 2-[(1R)-1-carboxylato-2-(4-hydroxyphenyl)ethyl]-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 7013168 |
| Molecular Formula | C18H11NO7-2 |
| Molecular Weight | 353.29 g/mol |
| Exact Mass | 353.05 |
| IUPAC Name | 2-[(1R)-1-carboxylato-2-(4-hydroxyphenyl)ethyl]-1,3-dioxoisoindole-5-carboxylate |
| SMILES | O=C([O-])c1ccc2c(c1)C(=O)N([C@H](Cc1ccc(O)cc1)C(=O)[O-])C2=O |
| InChI | InChI=1S/C18H13NO7/c20-11-4-1-9(2-5-11)7-14(18(25)26)19-15(21)12-6-3-10(17(23)24)8-13(12)16(19)22/h1-6,8,14,20H,7H2,(H,23,24)(H,25,26)/p-2/t14-/m1/s1 |
| InChIKey | QISJEFYTLZTWIQ-CQSZACIVSA-L |
| XLogP | -1.29 |
| TPSA | 137.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.29 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|