C14H13BrNNaO4 — CID 19205608
sodium 2-(5-bromo-1,3-dioxoisoindol-2-yl)-4-methylpentanoate (PubChem CID 19205608) has the molecular formula C14H13BrNNaO4 and a molecular weight of 362.16 g/mol. Its IUPAC name is sodium 2-(5-bromo-1,3-dioxoisoindol-2-yl)-4-methylpentanoate.
| Compound Name | sodium 2-(5-bromo-1,3-dioxoisoindol-2-yl)-4-methylpentanoate |
|---|---|
| PubChem CID | 19205608 |
| Molecular Formula | C14H13BrNNaO4 |
| Molecular Weight | 362.16 g/mol |
| Exact Mass | 360.99 |
| IUPAC Name | sodium 2-(5-bromo-1,3-dioxoisoindol-2-yl)-4-methylpentanoate |
| SMILES | CC(C)CC(C(=O)[O-])N1C(=O)c2ccc(Br)cc2C1=O.[Na+] |
| InChI | InChI=1S/C14H14BrNO4.Na/c1-7(2)5-11(14(19)20)16-12(17)9-4-3-8(15)6-10(9)13(16)18;/h3-4,6-7,11H,5H2,1-2H3,(H,19,20);/q;+1/p-1 |
| InChIKey | UWLZKJSONMYKOA-UHFFFAOYSA-M |
| XLogP | -1.79 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.16 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|