C12H9Br2NO3 — CID 174666403
5-bromo-2-(4-bromo-3-oxobutan-2-yl)isoindole-1,3-dione (PubChem CID 174666403) has the molecular formula C12H9Br2NO3 and a molecular weight of 375.02 g/mol. Its IUPAC name is 5-bromo-2-(4-bromo-3-oxobutan-2-yl)isoindole-1,3-dione.
| Compound Name | 5-bromo-2-(4-bromo-3-oxobutan-2-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 174666403 |
| Molecular Formula | C12H9Br2NO3 |
| Molecular Weight | 375.02 g/mol |
| Exact Mass | 372.89 |
| IUPAC Name | 5-bromo-2-(4-bromo-3-oxobutan-2-yl)isoindole-1,3-dione |
| SMILES | CC(C(=O)CBr)N1C(=O)c2ccc(Br)cc2C1=O |
| InChI | InChI=1S/C12H9Br2NO3/c1-6(10(16)5-13)15-11(17)8-3-2-7(14)4-9(8)12(15)18/h2-4,6H,5H2,1H3 |
| InChIKey | DZOHJXJNOZZNPK-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.02 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|