C15H18BrNO3 — CID 106353617
5-bromo-2-(1-hydroxy-4,4-dimethylpentan-3-yl)isoindole-1,3-dione (PubChem CID 106353617) has the molecular formula C15H18BrNO3 and a molecular weight of 340.22 g/mol. Its IUPAC name is 5-bromo-2-(1-hydroxy-4,4-dimethylpentan-3-yl)isoindole-1,3-dione.
| Compound Name | 5-bromo-2-(1-hydroxy-4,4-dimethylpentan-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 106353617 |
| Molecular Formula | C15H18BrNO3 |
| Molecular Weight | 340.22 g/mol |
| Exact Mass | 339.05 |
| IUPAC Name | 5-bromo-2-(1-hydroxy-4,4-dimethylpentan-3-yl)isoindole-1,3-dione |
| SMILES | CC(C)(C)C(CCO)N1C(=O)c2ccc(Br)cc2C1=O |
| InChI | InChI=1S/C15H18BrNO3/c1-15(2,3)12(6-7-18)17-13(19)10-5-4-9(16)8-11(10)14(17)20/h4-5,8,12,18H,6-7H2,1-3H3 |
| InChIKey | LXASUMDFTXSXMJ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.22 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|