C13H14BrNO3S — CID 106246368
5-bromo-2-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)isoindole-1,3-dione (PubChem CID 106246368) has the molecular formula C13H14BrNO3S and a molecular weight of 344.23 g/mol. Its IUPAC name is 5-bromo-2-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)isoindole-1,3-dione.
| Compound Name | 5-bromo-2-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 106246368 |
| Molecular Formula | C13H14BrNO3S |
| Molecular Weight | 344.23 g/mol |
| Exact Mass | 342.99 |
| IUPAC Name | 5-bromo-2-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)isoindole-1,3-dione |
| SMILES | CSCC(C)(O)CN1C(=O)c2ccc(Br)cc2C1=O |
| InChI | InChI=1S/C13H14BrNO3S/c1-13(18,7-19-2)6-15-11(16)9-4-3-8(14)5-10(9)12(15)17/h3-5,18H,6-7H2,1-2H3 |
| InChIKey | FFKDJPAGPHSPJV-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.23 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|