C19H26N2O3 — CID 20633738
2-(7-amino-2,2,7-trimethyl-6-oxooctan-3-yl)isoindole-1,3-dione (PubChem CID 20633738) has the molecular formula C19H26N2O3 and a molecular weight of 330.43 g/mol. Its IUPAC name is 2-(7-amino-2,2,7-trimethyl-6-oxooctan-3-yl)isoindole-1,3-dione.
| Compound Name | 2-(7-amino-2,2,7-trimethyl-6-oxooctan-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 20633738 |
| Molecular Formula | C19H26N2O3 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | 2-(7-amino-2,2,7-trimethyl-6-oxooctan-3-yl)isoindole-1,3-dione |
| SMILES | CC(C)(N)C(=O)CCC(N1C(=O)c2ccccc2C1=O)C(C)(C)C |
| InChI | InChI=1S/C19H26N2O3/c1-18(2,3)14(10-11-15(22)19(4,5)20)21-16(23)12-8-6-7-9-13(12)17(21)24/h6-9,14H,10-11,20H2,1-5H3 |
| InChIKey | ALFZWENOCXGKFR-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|