C16H17ClN2O4 — CID 139910601
(2S,4S)-2-amino-4-(1,3-dioxoisoindol-2-yl)-2-ethyl-3-oxohexanoyl chloride (PubChem CID 139910601) has the molecular formula C16H17ClN2O4 and a molecular weight of 336.78 g/mol. Its IUPAC name is (2S,4S)-2-amino-4-(1,3-dioxoisoindol-2-yl)-2-ethyl-3-oxohexanoyl chloride.
| Compound Name | (2S,4S)-2-amino-4-(1,3-dioxoisoindol-2-yl)-2-ethyl-3-oxohexanoyl chloride |
|---|---|
| PubChem CID | 139910601 |
| Molecular Formula | C16H17ClN2O4 |
| Molecular Weight | 336.78 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | (2S,4S)-2-amino-4-(1,3-dioxoisoindol-2-yl)-2-ethyl-3-oxohexanoyl chloride |
| SMILES | CC[C@@H](C(=O)[C@@](N)(CC)C(=O)Cl)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C16H17ClN2O4/c1-3-11(12(20)16(18,4-2)15(17)23)19-13(21)9-7-5-6-8-10(9)14(19)22/h5-8,11H,3-4,18H2,1-2H3/t11-,16-/m0/s1 |
| InChIKey | ZSTYLQGLCRWXJO-ZBEGNZNMSA-N |
| XLogP | 1.50 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.78 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|