C16H16N3O3S+ — CID 87563404
2-[1-(2-amino-1,3-thiazol-3-ium-3-yl)-2-oxopentan-3-yl]isoindole-1,3-dione (PubChem CID 87563404) has the molecular formula C16H16N3O3S+ and a molecular weight of 330.39 g/mol. Its IUPAC name is 2-[1-(2-amino-1,3-thiazol-3-ium-3-yl)-2-oxopentan-3-yl]isoindole-1,3-dione.
| Compound Name | 2-[1-(2-amino-1,3-thiazol-3-ium-3-yl)-2-oxopentan-3-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 87563404 |
| Molecular Formula | C16H16N3O3S+ |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | 2-[1-(2-amino-1,3-thiazol-3-ium-3-yl)-2-oxopentan-3-yl]isoindole-1,3-dione |
| SMILES | CCC(C(=O)C[n+]1ccsc1N)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C16H15N3O3S/c1-2-12(13(20)9-18-7-8-23-16(18)17)19-14(21)10-5-3-4-6-11(10)15(19)22/h3-8,12,17H,2,9H2,1H3/p+1 |
| InChIKey | WMVRBWMAVWJXDC-UHFFFAOYSA-O |
| XLogP | 1.26 |
| TPSA | 84.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|