C18H26N2O5 — CID 158816585
6-amino-2-(1,3-dioxoisoindol-2-yl)-6-methyl-5-oxoheptanoic acid;methane (PubChem CID 158816585) has the molecular formula C18H26N2O5 and a molecular weight of 350.42 g/mol. Its IUPAC name is 6-amino-2-(1,3-dioxoisoindol-2-yl)-6-methyl-5-oxoheptanoic acid;methane.
| Compound Name | 6-amino-2-(1,3-dioxoisoindol-2-yl)-6-methyl-5-oxoheptanoic acid;methane |
|---|---|
| PubChem CID | 158816585 |
| Molecular Formula | C18H26N2O5 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | 6-amino-2-(1,3-dioxoisoindol-2-yl)-6-methyl-5-oxoheptanoic acid;methane |
| SMILES | C.C.CC(C)(N)C(=O)CCC(C(=O)O)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C16H18N2O5.2CH4/c1-16(2,17)12(19)8-7-11(15(22)23)18-13(20)9-5-3-4-6-10(9)14(18)21;;/h3-6,11H,7-8,17H2,1-2H3,(H,22,23);2*1H4 |
| InChIKey | IVIRJAKRACUWPU-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 117.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|