C14H12ClNO4 — CID 22959420
2-(1,3-dioxoisoindol-2-yl)-5-oxohexanoyl chloride (PubChem CID 22959420) has the molecular formula C14H12ClNO4 and a molecular weight of 293.71 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-5-oxohexanoyl chloride.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-5-oxohexanoyl chloride |
|---|---|
| PubChem CID | 22959420 |
| Molecular Formula | C14H12ClNO4 |
| Molecular Weight | 293.71 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-5-oxohexanoyl chloride |
| SMILES | CC(=O)CCC(C(=O)Cl)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C14H12ClNO4/c1-8(17)6-7-11(12(15)18)16-13(19)9-4-2-3-5-10(9)14(16)20/h2-5,11H,6-7H2,1H3 |
| InChIKey | YYHDSHQERNVUNT-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.71 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|