C18H15NO4 — CID 154722861
(2S)-2-(1,3-dioxoisoindol-2-yl)-3-(4-methylphenyl)propanoic acid (PubChem CID 154722861) has the molecular formula C18H15NO4 and a molecular weight of 309.32 g/mol. Its IUPAC name is (2S)-2-(1,3-dioxoisoindol-2-yl)-3-(4-methylphenyl)propanoic acid.
| Compound Name | (2S)-2-(1,3-dioxoisoindol-2-yl)-3-(4-methylphenyl)propanoic acid |
|---|---|
| PubChem CID | 154722861 |
| Molecular Formula | C18H15NO4 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | (2S)-2-(1,3-dioxoisoindol-2-yl)-3-(4-methylphenyl)propanoic acid |
| SMILES | Cc1ccc(C[C@@H](C(=O)O)N2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C18H15NO4/c1-11-6-8-12(9-7-11)10-15(18(22)23)19-16(20)13-4-2-3-5-14(13)17(19)21/h2-9,15H,10H2,1H3,(H,22,23)/t15-/m0/s1 |
| InChIKey | BYRVVZZPJGBKNP-HNNXBMFYSA-N |
| XLogP | 2.29 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|