C17H12INO4 — CID 154723091
(2S)-2-(1,3-dioxoisoindol-2-yl)-3-(3-iodophenyl)propanoic acid (PubChem CID 154723091) has the molecular formula C17H12INO4 and a molecular weight of 421.19 g/mol. Its IUPAC name is (2S)-2-(1,3-dioxoisoindol-2-yl)-3-(3-iodophenyl)propanoic acid.
| Compound Name | (2S)-2-(1,3-dioxoisoindol-2-yl)-3-(3-iodophenyl)propanoic acid |
|---|---|
| PubChem CID | 154723091 |
| Molecular Formula | C17H12INO4 |
| Molecular Weight | 421.19 g/mol |
| Exact Mass | 420.98 |
| IUPAC Name | (2S)-2-(1,3-dioxoisoindol-2-yl)-3-(3-iodophenyl)propanoic acid |
| SMILES | O=C(O)[C@H](Cc1cccc(I)c1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C17H12INO4/c18-11-5-3-4-10(8-11)9-14(17(22)23)19-15(20)12-6-1-2-7-13(12)16(19)21/h1-8,14H,9H2,(H,22,23)/t14-/m0/s1 |
| InChIKey | HDRPEJOHFLFROL-AWEZNQCLSA-N |
| XLogP | 2.58 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.19 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|