C14H11Br2NO4 — CID 135273333
2-(3,4-dibromo-2,5-dioxopyrrol-1-yl)-3-(4-methylphenyl)propanoic acid (PubChem CID 135273333) has the molecular formula C14H11Br2NO4 and a molecular weight of 417.05 g/mol. Its IUPAC name is 2-(3,4-dibromo-2,5-dioxopyrrol-1-yl)-3-(4-methylphenyl)propanoic acid.
| Compound Name | 2-(3,4-dibromo-2,5-dioxopyrrol-1-yl)-3-(4-methylphenyl)propanoic acid |
|---|---|
| PubChem CID | 135273333 |
| Molecular Formula | C14H11Br2NO4 |
| Molecular Weight | 417.05 g/mol |
| Exact Mass | 414.91 |
| IUPAC Name | 2-(3,4-dibromo-2,5-dioxopyrrol-1-yl)-3-(4-methylphenyl)propanoic acid |
| SMILES | Cc1ccc(CC(C(=O)O)N2C(=O)C(Br)=C(Br)C2=O)cc1 |
| InChI | InChI=1S/C14H11Br2NO4/c1-7-2-4-8(5-3-7)6-9(14(20)21)17-12(18)10(15)11(16)13(17)19/h2-5,9H,6H2,1H3,(H,20,21) |
| InChIKey | MNHGXTSCBCFCQT-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.05 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|