C17H16BrFO2 — CID 60794341
2-[(2-bromo-5-fluorophenyl)methyl]-3-(4-methylphenyl)propanoic acid (PubChem CID 60794341) has the molecular formula C17H16BrFO2 and a molecular weight of 351.22 g/mol. Its IUPAC name is 2-[(2-bromo-5-fluorophenyl)methyl]-3-(4-methylphenyl)propanoic acid.
| Compound Name | 2-[(2-bromo-5-fluorophenyl)methyl]-3-(4-methylphenyl)propanoic acid |
|---|---|
| PubChem CID | 60794341 |
| Molecular Formula | C17H16BrFO2 |
| Molecular Weight | 351.22 g/mol |
| Exact Mass | 350.03 |
| IUPAC Name | 2-[(2-bromo-5-fluorophenyl)methyl]-3-(4-methylphenyl)propanoic acid |
| SMILES | Cc1ccc(CC(Cc2cc(F)ccc2Br)C(=O)O)cc1 |
| InChI | InChI=1S/C17H16BrFO2/c1-11-2-4-12(5-3-11)8-14(17(20)21)9-13-10-15(19)6-7-16(13)18/h2-7,10,14H,8-9H2,1H3,(H,20,21) |
| InChIKey | COSDOQWVRBGBKB-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.22 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |