C17H17FO2 — CID 60793481
2-[(2-fluorophenyl)methyl]-3-(4-methylphenyl)propanoic acid (PubChem CID 60793481) has the molecular formula C17H17FO2 and a molecular weight of 272.32 g/mol. Its IUPAC name is 2-[(2-fluorophenyl)methyl]-3-(4-methylphenyl)propanoic acid.
| Compound Name | 2-[(2-fluorophenyl)methyl]-3-(4-methylphenyl)propanoic acid |
|---|---|
| PubChem CID | 60793481 |
| Molecular Formula | C17H17FO2 |
| Molecular Weight | 272.32 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 2-[(2-fluorophenyl)methyl]-3-(4-methylphenyl)propanoic acid |
| SMILES | Cc1ccc(CC(Cc2ccccc2F)C(=O)O)cc1 |
| InChI | InChI=1S/C17H17FO2/c1-12-6-8-13(9-7-12)10-15(17(19)20)11-14-4-2-3-5-16(14)18/h2-9,15H,10-11H2,1H3,(H,19,20) |
| InChIKey | TVVAZTGDIBGOOS-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.32 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |