C10H12FNO2 — CID 42329482
(2R)-2-(aminomethyl)-3-(2-fluorophenyl)propanoic acid (PubChem CID 42329482) has the molecular formula C10H12FNO2 and a molecular weight of 197.21 g/mol. Its IUPAC name is (2R)-2-(aminomethyl)-3-(2-fluorophenyl)propanoic acid.
| Compound Name | (2R)-2-(aminomethyl)-3-(2-fluorophenyl)propanoic acid |
|---|---|
| PubChem CID | 42329482 |
| Molecular Formula | C10H12FNO2 |
| Molecular Weight | 197.21 g/mol |
| Exact Mass | 197.09 |
| IUPAC Name | (2R)-2-(aminomethyl)-3-(2-fluorophenyl)propanoic acid |
| SMILES | NC[C@@H](Cc1ccccc1F)C(=O)O |
| InChI | InChI=1S/C10H12FNO2/c11-9-4-2-1-3-7(9)5-8(6-12)10(13)14/h1-4,8H,5-6,12H2,(H,13,14)/t8-/m1/s1 |
| InChIKey | WZCLOOIHOICGMS-MRVPVSSYSA-N |
| XLogP | 1.03 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.21 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |