4-amino-2-[(2,3-difluorophenyl)methyl]butanoic acid

C11H13F2NO2 — CID 104680993

IUPAC4-amino-2-[(2,3-difluorophenyl)methyl]butanoic acid
SMILESNCCC(Cc1cccc(F)c1F)C(=O)O
InChIInChI=1S/C11H13F2NO2/c12-9-3-1-2-7(10(9)13)6-8(4-5-14)11(15)16/h1-3,8H,4-6,14H2,(H,15,16)
InChIKeyZSVZHQQBMYKMAP-UHFFFAOYSA-N
MW229.23 g/mol
LogP1.56
Rot. Bonds5

About 4-amino-2-[(2,3-difluorophenyl)methyl]butanoic acid

4-amino-2-[(2,3-difluorophenyl)methyl]butanoic acid (PubChem CID 104680993) has the molecular formula C11H13F2NO2 and a molecular weight of 229.23 g/mol. Its IUPAC name is 4-amino-2-[(2,3-difluorophenyl)methyl]butanoic acid.

Molecular Properties

Compound Name4-amino-2-[(2,3-difluorophenyl)methyl]butanoic acid
PubChem CID104680993
Molecular FormulaC11H13F2NO2
Molecular Weight229.23 g/mol
Exact Mass229.09
IUPAC Name4-amino-2-[(2,3-difluorophenyl)methyl]butanoic acid
SMILESNCCC(Cc1cccc(F)c1F)C(=O)O
InChIInChI=1S/C11H13F2NO2/c12-9-3-1-2-7(10(9)13)6-8(4-5-14)11(15)16/h1-3,8H,4-6,14H2,(H,15,16)
InChIKeyZSVZHQQBMYKMAP-UHFFFAOYSA-N
XLogP1.56
TPSA63.32 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500229.23
LogP ≤ 51.56
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 4-amino-2-[(2,3-difluorophenyl)methyl]butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-amino-2-[(2,3-difluorophenyl)methyl]butanoic acid?
The IUPAC name of 4-amino-2-[(2,3-difluorophenyl)methyl]butanoic acid (CID 104680993) is 4-amino-2-[(2,3-difluorophenyl)methyl]butanoic acid.
What is the SMILES notation for 4-amino-2-[(2,3-difluorophenyl)methyl]butanoic acid?
The canonical SMILES for 4-amino-2-[(2,3-difluorophenyl)methyl]butanoic acid is NCCC(Cc1cccc(F)c1F)C(=O)O.
What is the InChIKey of 4-amino-2-[(2,3-difluorophenyl)methyl]butanoic acid?
The InChIKey is ZSVZHQQBMYKMAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13F2NO2/c12-9-3-1-2-7(10(9)13)6-8(4-5-14)11(15)16/h1-3,8H,4-6,14H2,(H,15,16).
What are the key properties of 4-amino-2-[(2,3-difluorophenyl)methyl]butanoic acid?
4-amino-2-[(2,3-difluorophenyl)methyl]butanoic acid has a molecular weight of 229.23 g/mol, XLogP of 1.56, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-2-[(2,3-difluorophenyl)methyl]butanoic acid is sourced from PubChem (CID 104680993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).