C11H13F2NO2 — CID 63669742
methyl 2-(aminomethyl)-3-(2,3-difluorophenyl)propanoate (PubChem CID 63669742) has the molecular formula C11H13F2NO2 and a molecular weight of 229.23 g/mol. Its IUPAC name is methyl 2-(aminomethyl)-3-(2,3-difluorophenyl)propanoate.
| Compound Name | methyl 2-(aminomethyl)-3-(2,3-difluorophenyl)propanoate |
|---|---|
| PubChem CID | 63669742 |
| Molecular Formula | C11H13F2NO2 |
| Molecular Weight | 229.23 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | methyl 2-(aminomethyl)-3-(2,3-difluorophenyl)propanoate |
| SMILES | COC(=O)C(CN)Cc1cccc(F)c1F |
| InChI | InChI=1S/C11H13F2NO2/c1-16-11(15)8(6-14)5-7-3-2-4-9(12)10(7)13/h2-4,8H,5-6,14H2,1H3 |
| InChIKey | JIRMAPXUGGKLLX-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.23 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |