C13H16F2O2 — CID 83135397
2-[(2,3-difluorophenyl)methyl]-3,3-dimethylbutanoic acid (PubChem CID 83135397) has the molecular formula C13H16F2O2 and a molecular weight of 242.26 g/mol. Its IUPAC name is 2-[(2,3-difluorophenyl)methyl]-3,3-dimethylbutanoic acid.
| Compound Name | 2-[(2,3-difluorophenyl)methyl]-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 83135397 |
| Molecular Formula | C13H16F2O2 |
| Molecular Weight | 242.26 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 2-[(2,3-difluorophenyl)methyl]-3,3-dimethylbutanoic acid |
| SMILES | CC(C)(C)C(Cc1cccc(F)c1F)C(=O)O |
| InChI | InChI=1S/C13H16F2O2/c1-13(2,3)9(12(16)17)7-8-5-4-6-10(14)11(8)15/h4-6,9H,7H2,1-3H3,(H,16,17) |
| InChIKey | MFRBSQXLVZHJBG-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.26 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |