About 4-amino-2-benzylbutanoic acid
4-amino-2-benzylbutanoic acid (PubChem CID 16679765) has the molecular formula C11H15NO2
and a molecular weight of 193.25 g/mol. Its IUPAC name is 4-amino-2-benzylbutanoic acid.
Molecular Properties
| Compound Name | 4-amino-2-benzylbutanoic acid |
| PubChem CID | 16679765 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 4-amino-2-benzylbutanoic acid |
| SMILES | NCCC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C11H15NO2/c12-7-6-10(11(13)14)8-9-4-2-1-3-5-9/h1-5,10H,6-8,12H2,(H,13,14) |
| InChIKey | XAWSFIVAOWXDCN-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-amino-2-benzylbutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-2-benzylbutanoic acid?
The IUPAC name of 4-amino-2-benzylbutanoic acid (CID 16679765) is 4-amino-2-benzylbutanoic acid.
What is the SMILES notation for 4-amino-2-benzylbutanoic acid?
The canonical SMILES for 4-amino-2-benzylbutanoic acid is NCCC(Cc1ccccc1)C(=O)O.
What is the InChIKey of 4-amino-2-benzylbutanoic acid?
The InChIKey is XAWSFIVAOWXDCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO2/c12-7-6-10(11(13)14)8-9-4-2-1-3-5-9/h1-5,10H,6-8,12H2,(H,13,14).
What are the key properties of 4-amino-2-benzylbutanoic acid?
4-amino-2-benzylbutanoic acid has a molecular weight of 193.25 g/mol, XLogP of 1.28, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-2-benzylbutanoic acid is sourced from PubChem (CID 16679765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).