C14H17FO2 — CID 114473256
2-[(2-fluorophenyl)methyl]-5-methylhex-5-enoic acid (PubChem CID 114473256) has the molecular formula C14H17FO2 and a molecular weight of 236.29 g/mol. Its IUPAC name is 2-[(2-fluorophenyl)methyl]-5-methylhex-5-enoic acid.
| Compound Name | 2-[(2-fluorophenyl)methyl]-5-methylhex-5-enoic acid |
|---|---|
| PubChem CID | 114473256 |
| Molecular Formula | C14H17FO2 |
| Molecular Weight | 236.29 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | 2-[(2-fluorophenyl)methyl]-5-methylhex-5-enoic acid |
| SMILES | C=C(C)CCC(Cc1ccccc1F)C(=O)O |
| InChI | InChI=1S/C14H17FO2/c1-10(2)7-8-12(14(16)17)9-11-5-3-4-6-13(11)15/h3-6,12H,1,7-9H2,2H3,(H,16,17) |
| InChIKey | TZGBYWNPIOHMCZ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.29 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|