C10H14NO2+ — CID 59236931
[1-carboxy-2-(4-methylphenyl)ethyl]azanium (PubChem CID 59236931) has the molecular formula C10H14NO2+ and a molecular weight of 180.23 g/mol. Its IUPAC name is [1-carboxy-2-(4-methylphenyl)ethyl]azanium.
| Compound Name | [1-carboxy-2-(4-methylphenyl)ethyl]azanium |
|---|---|
| PubChem CID | 59236931 |
| Molecular Formula | C10H14NO2+ |
| Molecular Weight | 180.23 g/mol |
| Exact Mass | 180.10 |
| IUPAC Name | [1-carboxy-2-(4-methylphenyl)ethyl]azanium |
| SMILES | Cc1ccc(CC([NH3+])C(=O)O)cc1 |
| InChI | InChI=1S/C10H13NO2/c1-7-2-4-8(5-3-7)6-9(11)10(12)13/h2-5,9H,6,11H2,1H3,(H,12,13)/p+1 |
| InChIKey | DQLHSFUMICQIMB-UHFFFAOYSA-O |
| XLogP | 0.23 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.23 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |