C10H16NO2P3 — CID 59607691
2-[bis(phosphanyl)phosphanylamino]-3-(4-methylphenyl)propanoic acid (PubChem CID 59607691) has the molecular formula C10H16NO2P3 and a molecular weight of 275.17 g/mol. Its IUPAC name is 2-[bis(phosphanyl)phosphanylamino]-3-(4-methylphenyl)propanoic acid.
| Compound Name | 2-[bis(phosphanyl)phosphanylamino]-3-(4-methylphenyl)propanoic acid |
|---|---|
| PubChem CID | 59607691 |
| Molecular Formula | C10H16NO2P3 |
| Molecular Weight | 275.17 g/mol |
| Exact Mass | 275.04 |
| IUPAC Name | 2-[bis(phosphanyl)phosphanylamino]-3-(4-methylphenyl)propanoic acid |
| SMILES | Cc1ccc(CC(NP(P)P)C(=O)O)cc1 |
| InChI | InChI=1S/C10H16NO2P3/c1-7-2-4-8(5-3-7)6-9(10(12)13)11-16(14)15/h2-5,9,11H,6,14-15H2,1H3,(H,12,13) |
| InChIKey | JLDVEZFTEIKWNC-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.17 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|