C9H10F2NO2+ — CID 20769065
[1-carboxy-2-(3,4-difluorophenyl)ethyl]azanium (PubChem CID 20769065) has the molecular formula C9H10F2NO2+ and a molecular weight of 202.18 g/mol. Its IUPAC name is [1-carboxy-2-(3,4-difluorophenyl)ethyl]azanium.
| Compound Name | [1-carboxy-2-(3,4-difluorophenyl)ethyl]azanium |
|---|---|
| PubChem CID | 20769065 |
| Molecular Formula | C9H10F2NO2+ |
| Molecular Weight | 202.18 g/mol |
| Exact Mass | 202.07 |
| IUPAC Name | [1-carboxy-2-(3,4-difluorophenyl)ethyl]azanium |
| SMILES | [NH3+]C(Cc1ccc(F)c(F)c1)C(=O)O |
| InChI | InChI=1S/C9H9F2NO2/c10-6-2-1-5(3-7(6)11)4-8(12)9(13)14/h1-3,8H,4,12H2,(H,13,14)/p+1 |
| InChIKey | PRAWYXDDKCVZTL-UHFFFAOYSA-O |
| XLogP | 0.20 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.18 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |