C15H19F2NO4 — CID 56923733
(2S)-3-amino-4-(3,4-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonyl]butanoic acid (PubChem CID 56923733) has the molecular formula C15H19F2NO4 and a molecular weight of 315.32 g/mol. Its IUPAC name is (2S)-3-amino-4-(3,4-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonyl]butanoic acid.
| Compound Name | (2S)-3-amino-4-(3,4-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonyl]butanoic acid |
|---|---|
| PubChem CID | 56923733 |
| Molecular Formula | C15H19F2NO4 |
| Molecular Weight | 315.32 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | (2S)-3-amino-4-(3,4-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonyl]butanoic acid |
| SMILES | CC(C)(C)OC(=O)[C@H](C(=O)O)C(N)Cc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C15H19F2NO4/c1-15(2,3)22-14(21)12(13(19)20)11(18)7-8-4-5-9(16)10(17)6-8/h4-6,11-12H,7,18H2,1-3H3,(H,19,20)/t11?,12-/m0/s1 |
| InChIKey | FKWVZNLWWHHZNF-KIYNQFGBSA-N |
| XLogP | 1.88 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.32 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|