C15H16F5NO4 — CID 57376503
(2R)-3-amino-2-[(2-methylpropan-2-yl)oxycarbonyl]-4-(2,3,4,5,6-pentafluorophenyl)butanoic acid (PubChem CID 57376503) has the molecular formula C15H16F5NO4 and a molecular weight of 369.29 g/mol. Its IUPAC name is (2R)-3-amino-2-[(2-methylpropan-2-yl)oxycarbonyl]-4-(2,3,4,5,6-pentafluorophenyl)butanoic acid.
| Compound Name | (2R)-3-amino-2-[(2-methylpropan-2-yl)oxycarbonyl]-4-(2,3,4,5,6-pentafluorophenyl)butanoic acid |
|---|---|
| PubChem CID | 57376503 |
| Molecular Formula | C15H16F5NO4 |
| Molecular Weight | 369.29 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | (2R)-3-amino-2-[(2-methylpropan-2-yl)oxycarbonyl]-4-(2,3,4,5,6-pentafluorophenyl)butanoic acid |
| SMILES | CC(C)(C)OC(=O)[C@@H](C(=O)O)C(N)Cc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C15H16F5NO4/c1-15(2,3)25-14(24)7(13(22)23)6(21)4-5-8(16)10(18)12(20)11(19)9(5)17/h6-7H,4,21H2,1-3H3,(H,22,23)/t6?,7-/m1/s1 |
| InChIKey | NFJJJAGTDQBYAH-COBSHVIPSA-N |
| XLogP | 2.29 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.29 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|