C16H20F3NO4 — CID 95475888
(2R,3R)-3-amino-2-[(2-methylpropan-2-yl)oxycarbonyl]-4-[2-(trifluoromethyl)phenyl]butanoic acid (PubChem CID 95475888) has the molecular formula C16H20F3NO4 and a molecular weight of 347.33 g/mol. Its IUPAC name is (2R,3R)-3-amino-2-[(2-methylpropan-2-yl)oxycarbonyl]-4-[2-(trifluoromethyl)phenyl]butanoic acid.
| Compound Name | (2R,3R)-3-amino-2-[(2-methylpropan-2-yl)oxycarbonyl]-4-[2-(trifluoromethyl)phenyl]butanoic acid |
|---|---|
| PubChem CID | 95475888 |
| Molecular Formula | C16H20F3NO4 |
| Molecular Weight | 347.33 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | (2R,3R)-3-amino-2-[(2-methylpropan-2-yl)oxycarbonyl]-4-[2-(trifluoromethyl)phenyl]butanoic acid |
| SMILES | CC(C)(C)OC(=O)[C@@H](C(=O)O)[C@H](N)Cc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C16H20F3NO4/c1-15(2,3)24-14(23)12(13(21)22)11(20)8-9-6-4-5-7-10(9)16(17,18)19/h4-7,11-12H,8,20H2,1-3H3,(H,21,22)/t11-,12-/m1/s1 |
| InChIKey | GKRJGESBCLDROC-VXGBXAGGSA-N |
| XLogP | 2.62 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.33 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|