C16H23NO4 — CID 71433228
(2R)-4-amino-2-[(2-methylpropan-2-yl)oxycarbonyl]-5-phenylpentanoic acid (PubChem CID 71433228) has the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. Its IUPAC name is (2R)-4-amino-2-[(2-methylpropan-2-yl)oxycarbonyl]-5-phenylpentanoic acid.
| Compound Name | (2R)-4-amino-2-[(2-methylpropan-2-yl)oxycarbonyl]-5-phenylpentanoic acid |
|---|---|
| PubChem CID | 71433228 |
| Molecular Formula | C16H23NO4 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | (2R)-4-amino-2-[(2-methylpropan-2-yl)oxycarbonyl]-5-phenylpentanoic acid |
| SMILES | CC(C)(C)OC(=O)[C@H](CC(N)Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C16H23NO4/c1-16(2,3)21-15(20)13(14(18)19)10-12(17)9-11-7-5-4-6-8-11/h4-8,12-13H,9-10,17H2,1-3H3,(H,18,19)/t12?,13-/m1/s1 |
| InChIKey | OTKMNTHHPCBWHH-ZGTCLIOFSA-N |
| XLogP | 1.99 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|