C21H30O5 — CID 56929485
ditert-butyl 2-(2-benzyl-3-oxopropyl)propanedioate (PubChem CID 56929485) has the molecular formula C21H30O5 and a molecular weight of 362.47 g/mol. Its IUPAC name is ditert-butyl 2-(2-benzyl-3-oxopropyl)propanedioate.
| Compound Name | ditert-butyl 2-(2-benzyl-3-oxopropyl)propanedioate |
|---|---|
| PubChem CID | 56929485 |
| Molecular Formula | C21H30O5 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | ditert-butyl 2-(2-benzyl-3-oxopropyl)propanedioate |
| SMILES | CC(C)(C)OC(=O)C(CC(C=O)Cc1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H30O5/c1-20(2,3)25-18(23)17(19(24)26-21(4,5)6)13-16(14-22)12-15-10-8-7-9-11-15/h7-11,14,16-17H,12-13H2,1-6H3 |
| InChIKey | BUDCCWYPHIPGKZ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|