C10H12F3NO2 — CID 135188548
2-amino-3-[2-(trifluoromethyl)phenyl]propane-1,1-diol (PubChem CID 135188548) has the molecular formula C10H12F3NO2 and a molecular weight of 235.20 g/mol. Its IUPAC name is 2-amino-3-[2-(trifluoromethyl)phenyl]propane-1,1-diol.
| Compound Name | 2-amino-3-[2-(trifluoromethyl)phenyl]propane-1,1-diol |
|---|---|
| PubChem CID | 135188548 |
| Molecular Formula | C10H12F3NO2 |
| Molecular Weight | 235.20 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | 2-amino-3-[2-(trifluoromethyl)phenyl]propane-1,1-diol |
| SMILES | NC(Cc1ccccc1C(F)(F)F)C(O)O |
| InChI | InChI=1S/C10H12F3NO2/c11-10(12,13)7-4-2-1-3-6(7)5-8(14)9(15)16/h1-4,8-9,15-16H,5,14H2 |
| InChIKey | DNYBYVYUVVQNJP-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.20 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|