C13H16BrF3 — CID 63530722
1-(2-bromo-3,3-dimethylbutyl)-2-(trifluoromethyl)benzene (PubChem CID 63530722) has the molecular formula C13H16BrF3 and a molecular weight of 309.17 g/mol. Its IUPAC name is 1-(2-bromo-3,3-dimethylbutyl)-2-(trifluoromethyl)benzene.
| Compound Name | 1-(2-bromo-3,3-dimethylbutyl)-2-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 63530722 |
| Molecular Formula | C13H16BrF3 |
| Molecular Weight | 309.17 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | 1-(2-bromo-3,3-dimethylbutyl)-2-(trifluoromethyl)benzene |
| SMILES | CC(C)(C)C(Br)Cc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C13H16BrF3/c1-12(2,3)11(14)8-9-6-4-5-7-10(9)13(15,16)17/h4-7,11H,8H2,1-3H3 |
| InChIKey | RRXVNXIWRXPBCT-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.17 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|