C11H13F3O2 — CID 175401448
1-[2-(trifluoromethyl)phenyl]butane-2,3-diol (PubChem CID 175401448) has the molecular formula C11H13F3O2 and a molecular weight of 234.22 g/mol. Its IUPAC name is 1-[2-(trifluoromethyl)phenyl]butane-2,3-diol.
| Compound Name | 1-[2-(trifluoromethyl)phenyl]butane-2,3-diol |
|---|---|
| PubChem CID | 175401448 |
| Molecular Formula | C11H13F3O2 |
| Molecular Weight | 234.22 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 1-[2-(trifluoromethyl)phenyl]butane-2,3-diol |
| SMILES | CC(O)C(O)Cc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C11H13F3O2/c1-7(15)10(16)6-8-4-2-3-5-9(8)11(12,13)14/h2-5,7,10,15-16H,6H2,1H3 |
| InChIKey | XUCAXKGGLPXDNM-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.22 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |