C9H17NO5 — CID 174431807
3-amino-4-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonyl]butanoic acid (PubChem CID 174431807) has the molecular formula C9H17NO5 and a molecular weight of 219.24 g/mol. Its IUPAC name is 3-amino-4-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonyl]butanoic acid.
| Compound Name | 3-amino-4-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonyl]butanoic acid |
|---|---|
| PubChem CID | 174431807 |
| Molecular Formula | C9H17NO5 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | 3-amino-4-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonyl]butanoic acid |
| SMILES | CC(C)(C)OC(=O)C(C(=O)O)C(N)CO |
| InChI | InChI=1S/C9H17NO5/c1-9(2,3)15-8(14)6(7(12)13)5(10)4-11/h5-6,11H,4,10H2,1-3H3,(H,12,13) |
| InChIKey | GVKOELYLKHUWMC-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|