C10H14NNaO3 — CID 160538956
sodium;(2S)-2-amino-3-(4-methylphenyl)propanoic acid;hydroxide (PubChem CID 160538956) has the molecular formula C10H14NNaO3 and a molecular weight of 219.22 g/mol. Its IUPAC name is sodium;(2S)-2-amino-3-(4-methylphenyl)propanoic acid;hydroxide.
| Compound Name | sodium;(2S)-2-amino-3-(4-methylphenyl)propanoic acid;hydroxide |
|---|---|
| PubChem CID | 160538956 |
| Molecular Formula | C10H14NNaO3 |
| Molecular Weight | 219.22 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | sodium;(2S)-2-amino-3-(4-methylphenyl)propanoic acid;hydroxide |
| SMILES | Cc1ccc(C[C@H](N)C(=O)O)cc1.[Na+].[OH-] |
| InChI | InChI=1S/C10H13NO2.Na.H2O/c1-7-2-4-8(5-3-7)6-9(11)10(12)13;;/h2-5,9H,6,11H2,1H3,(H,12,13);;1H2/q;+1;/p-1/t9-;;/m0../s1 |
| InChIKey | QWNGLHGQPYFMFN-WWPIYYJJSA-M |
| XLogP | -2.22 |
| TPSA | 93.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.22 |
| LogP ≤ 5 | -2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |