C19H25NO5 — CID 134882925
tert-butyl 2-(1,3-dioxoisoindol-2-yl)-3-[(2-methylpropan-2-yl)oxy]propanoate (PubChem CID 134882925) has the molecular formula C19H25NO5 and a molecular weight of 347.41 g/mol. Its IUPAC name is tert-butyl 2-(1,3-dioxoisoindol-2-yl)-3-[(2-methylpropan-2-yl)oxy]propanoate.
| Compound Name | tert-butyl 2-(1,3-dioxoisoindol-2-yl)-3-[(2-methylpropan-2-yl)oxy]propanoate |
|---|---|
| PubChem CID | 134882925 |
| Molecular Formula | C19H25NO5 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | tert-butyl 2-(1,3-dioxoisoindol-2-yl)-3-[(2-methylpropan-2-yl)oxy]propanoate |
| SMILES | CC(C)(C)OCC(C(=O)OC(C)(C)C)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C19H25NO5/c1-18(2,3)24-11-14(17(23)25-19(4,5)6)20-15(21)12-9-7-8-10-13(12)16(20)22/h7-10,14H,11H2,1-6H3 |
| InChIKey | FELIZPXRPAUHKD-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|