C22H21Cl2NO4S — CID 102595936
tert-butyl (2S)-3-benzylsulfanyl-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 102595936) has the molecular formula C22H21Cl2NO4S and a molecular weight of 466.39 g/mol. Its IUPAC name is tert-butyl (2S)-3-benzylsulfanyl-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)propanoate.
| Compound Name | tert-butyl (2S)-3-benzylsulfanyl-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 102595936 |
| Molecular Formula | C22H21Cl2NO4S |
| Molecular Weight | 466.39 g/mol |
| Exact Mass | 465.06 |
| IUPAC Name | tert-butyl (2S)-3-benzylsulfanyl-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | CC(C)(C)OC(=O)[C@@H](CSCc1ccccc1)N1C(=O)c2cc(Cl)c(Cl)cc2C1=O |
| InChI | InChI=1S/C22H21Cl2NO4S/c1-22(2,3)29-21(28)18(12-30-11-13-7-5-4-6-8-13)25-19(26)14-9-16(23)17(24)10-15(14)20(25)27/h4-10,18H,11-12H2,1-3H3/t18-/m1/s1 |
| InChIKey | AZVXNZPREPPPDL-GOSISDBHSA-N |
| XLogP | 5.23 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.39 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|