C16H24O3S — CID 102379046
tert-butyl (2R,3R)-2-(benzylsulfanylmethyl)-3-hydroxybutanoate (PubChem CID 102379046) has the molecular formula C16H24O3S and a molecular weight of 296.43 g/mol. Its IUPAC name is tert-butyl (2R,3R)-2-(benzylsulfanylmethyl)-3-hydroxybutanoate.
| Compound Name | tert-butyl (2R,3R)-2-(benzylsulfanylmethyl)-3-hydroxybutanoate |
|---|---|
| PubChem CID | 102379046 |
| Molecular Formula | C16H24O3S |
| Molecular Weight | 296.43 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | tert-butyl (2R,3R)-2-(benzylsulfanylmethyl)-3-hydroxybutanoate |
| SMILES | C[C@@H](O)[C@@H](CSCc1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H24O3S/c1-12(17)14(15(18)19-16(2,3)4)11-20-10-13-8-6-5-7-9-13/h5-9,12,14,17H,10-11H2,1-4H3/t12-,14-/m1/s1 |
| InChIKey | XWFCIJKPARABIA-TZMCWYRMSA-N |
| XLogP | 3.26 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.43 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |