C24H37N3O7S — CID 71275636
methyl 3-benzylsulfanyl-2-[[bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]carbamoylamino]propanoate (PubChem CID 71275636) has the molecular formula C24H37N3O7S and a molecular weight of 511.64 g/mol. Its IUPAC name is methyl 3-benzylsulfanyl-2-[[bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]carbamoylamino]propanoate.
| Compound Name | methyl 3-benzylsulfanyl-2-[[bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]carbamoylamino]propanoate |
|---|---|
| PubChem CID | 71275636 |
| Molecular Formula | C24H37N3O7S |
| Molecular Weight | 511.64 g/mol |
| Exact Mass | 511.24 |
| IUPAC Name | methyl 3-benzylsulfanyl-2-[[bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]carbamoylamino]propanoate |
| SMILES | COC(=O)C(CSCc1ccccc1)NC(=O)NN(CC(=O)OC(C)(C)C)CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H37N3O7S/c1-23(2,3)33-19(28)13-27(14-20(29)34-24(4,5)6)26-22(31)25-18(21(30)32-7)16-35-15-17-11-9-8-10-12-17/h8-12,18H,13-16H2,1-7H3,(H2,25,26,31) |
| InChIKey | VKKOVTBPIKYLBV-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 123.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.64 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|