C18H19NO5S — CID 155565177
methyl (2R)-3-benzylsulfanyl-2-[(3,5-dihydroxybenzoyl)amino]propanoate (PubChem CID 155565177) has the molecular formula C18H19NO5S and a molecular weight of 361.42 g/mol. Its IUPAC name is methyl (2R)-3-benzylsulfanyl-2-[(3,5-dihydroxybenzoyl)amino]propanoate.
| Compound Name | methyl (2R)-3-benzylsulfanyl-2-[(3,5-dihydroxybenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 155565177 |
| Molecular Formula | C18H19NO5S |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | methyl (2R)-3-benzylsulfanyl-2-[(3,5-dihydroxybenzoyl)amino]propanoate |
| SMILES | COC(=O)[C@H](CSCc1ccccc1)NC(=O)c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C18H19NO5S/c1-24-18(23)16(11-25-10-12-5-3-2-4-6-12)19-17(22)13-7-14(20)9-15(21)8-13/h2-9,16,20-21H,10-11H2,1H3,(H,19,22)/t16-/m0/s1 |
| InChIKey | ZVLZYCGCNQAYOK-INIZCTEOSA-N |
| XLogP | 2.30 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |