C22H25NO4S — CID 71535261
methyl (2R)-3-(2,2-dimethylpropanoylsulfanyl)-2-[(4-phenylbenzoyl)amino]propanoate (PubChem CID 71535261) has the molecular formula C22H25NO4S and a molecular weight of 399.51 g/mol. Its IUPAC name is methyl (2R)-3-(2,2-dimethylpropanoylsulfanyl)-2-[(4-phenylbenzoyl)amino]propanoate.
| Compound Name | methyl (2R)-3-(2,2-dimethylpropanoylsulfanyl)-2-[(4-phenylbenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 71535261 |
| Molecular Formula | C22H25NO4S |
| Molecular Weight | 399.51 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | methyl (2R)-3-(2,2-dimethylpropanoylsulfanyl)-2-[(4-phenylbenzoyl)amino]propanoate |
| SMILES | COC(=O)[C@H](CSC(=O)C(C)(C)C)NC(=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C22H25NO4S/c1-22(2,3)21(26)28-14-18(20(25)27-4)23-19(24)17-12-10-16(11-13-17)15-8-6-5-7-9-15/h5-13,18H,14H2,1-4H3,(H,23,24)/t18-/m0/s1 |
| InChIKey | IKNYVFRIJMZHSB-SFHVURJKSA-N |
| XLogP | 3.93 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.51 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|