C25H39NO3S2 — CID 70659039
methyl 2-benzamido-8-tert-butylsulfanyl-7-(tert-butylsulfanylmethyl)oct-4-enoate (PubChem CID 70659039) has the molecular formula C25H39NO3S2 and a molecular weight of 465.73 g/mol. Its IUPAC name is methyl 2-benzamido-8-tert-butylsulfanyl-7-(tert-butylsulfanylmethyl)oct-4-enoate.
| Compound Name | methyl 2-benzamido-8-tert-butylsulfanyl-7-(tert-butylsulfanylmethyl)oct-4-enoate |
|---|---|
| PubChem CID | 70659039 |
| Molecular Formula | C25H39NO3S2 |
| Molecular Weight | 465.73 g/mol |
| Exact Mass | 465.24 |
| IUPAC Name | methyl 2-benzamido-8-tert-butylsulfanyl-7-(tert-butylsulfanylmethyl)oct-4-enoate |
| SMILES | COC(=O)C(CC=CCC(CSC(C)(C)C)CSC(C)(C)C)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C25H39NO3S2/c1-24(2,3)30-17-19(18-31-25(4,5)6)13-11-12-16-21(23(28)29-7)26-22(27)20-14-9-8-10-15-20/h8-12,14-15,19,21H,13,16-18H2,1-7H3,(H,26,27) |
| InChIKey | RRXJFUWRBSWPDU-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.73 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|